Products 955959-87-2
CAS 955959-87-2 is the registry number for 4-(Dibenzo[b,d]furan-4-yl)-N-phenylaniline, 98%, 98%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg.
4-dibenzofuran-4-yl-N-phenylaniline (CAS 955959-87-2) is a chemical compound with the molecular formula C24H17NO and a molecular weight of 335.4 g/mol. IUPAC name: 4-dibenzofuran-4-yl-N-phenylaniline. InChIKey: GYMIEOQOEQMNMI-UHFFFAOYSA-N.
| Molecular formula | C24H17NO |
|---|---|
| Molecular weight | 335.4 g/mol |
| IUPAC name | 4-dibenzofuran-4-yl-N-phenylaniline |
| InChIKey | GYMIEOQOEQMNMI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=CC=C(C=C2)C3=CC=CC4=C3OC5=CC=CC=C45 |
Computed by PubChem (NCBI)