Products 95716-68-0
CAS 95716-68-0 appears in our catalog under these names: Paricalcitol Impurity 1, Paricalcitol Impurity 4 (PRC-2), Paricalcitol Impurity 3. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(1R,3aR,7aR)-1-[(E,2R,5S)-6-hydroxy-5,6-dimethylhept-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one (CAS 95716-68-0) is a chemical compound with the molecular formula C19H32O2 and a molecular weight of 292.5 g/mol. IUPAC name: (1R,3aR,7aR)-1-[(E,2R,5S)-6-hydroxy-5,6-dimethylhept-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one. InChIKey: QZJWXZGUOIMBAV-WXWTUHQWSA-N.
| Molecular formula | C19H32O2 |
|---|---|
| Molecular weight | 292.5 g/mol |
| IUPAC name | (1R,3aR,7aR)-1-[(E,2R,5S)-6-hydroxy-5,6-dimethylhept-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one |
| InChIKey | QZJWXZGUOIMBAV-WXWTUHQWSA-N |
| SMILES | C[C@H](/C=C/[C@H](C)C(C)(C)O)[C@H]1CC[C@@H]2[C@@]1(CCCC2=O)C |
Computed by PubChem (NCBI)