CAS 959003-56-6 is the registry number for 4-(4-(Methylsulfonyl)phenyl)-3-(p-tolyl)furan-2(5H)-one, 95%, 95%. Offered by: Chemat. Available pack sizes: 25mg, 100mg.
4-(4-methylphenyl)-3-(4-methylsulfonylphenyl)-2H-furan-5-one (CAS 959003-56-6) is a chemical compound with the molecular formula C18H16O4S and a molecular weight of 328.4 g/mol. IUPAC name: 4-(4-methylphenyl)-3-(4-methylsulfonylphenyl)-2H-furan-5-one. InChIKey: BLBVOPKWOIXAFD-UHFFFAOYSA-N.
| Molecular formula | C18H16O4S |
|---|---|
| Molecular weight | 328.4 g/mol |
| IUPAC name | 4-(4-methylphenyl)-3-(4-methylsulfonylphenyl)-2H-furan-5-one |
| InChIKey | BLBVOPKWOIXAFD-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=C(COC2=O)C3=CC=C(C=C3)S(=O)(=O)C |
Computed by PubChem (NCBI)