CAS 96561-53-4 appears in our catalog under these names: Droxidopa Impurity 16, L-Threo-(n-phthaloyl-3-(3,4-dihydroxyphenyl)serine). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg.
(2R,3R)-3-(3,4-dihydroxyphenyl)-2-(1,3-dioxoisoindol-2-yl)-3-hydroxypropanoic acid (CAS 96561-53-4) is a chemical compound with the molecular formula C17H13NO7 and a molecular weight of 343.29 g/mol. IUPAC name: (2R,3R)-3-(3,4-dihydroxyphenyl)-2-(1,3-dioxoisoindol-2-yl)-3-hydroxypropanoic acid. InChIKey: GOARNQSMYSYKHQ-ZIAGYGMSSA-N.
| Molecular formula | C17H13NO7 |
|---|---|
| Molecular weight | 343.29 g/mol |
| IUPAC name | (2R,3R)-3-(3,4-dihydroxyphenyl)-2-(1,3-dioxoisoindol-2-yl)-3-hydroxypropanoic acid |
| InChIKey | GOARNQSMYSYKHQ-ZIAGYGMSSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)[C@H]([C@@H](C3=CC(=C(C=C3)O)O)O)C(=O)O |
Computed by PubChem (NCBI)