CAS 99218-62-9 is the registry number for Potassium Mefenamate. Offered by: Chemat Brand. Available pack sizes: on request.
Potassium 2-(2,3-dimethylanilino)benzoate (CAS 99218-62-9) is a chemical compound with the molecular formula C15H14KNO2 and a molecular weight of 279.37 g/mol. IUPAC name: potassium 2-(2,3-dimethylanilino)benzoate. InChIKey: SGOCWSSUHRECPU-UHFFFAOYSA-M.
| Molecular formula | C15H14KNO2 |
|---|---|
| Molecular weight | 279.37 g/mol |
| IUPAC name | potassium 2-(2,3-dimethylanilino)benzoate |
| InChIKey | SGOCWSSUHRECPU-UHFFFAOYSA-M |
| SMILES | CC1=C(C(=CC=C1)NC2=CC=CC=C2C(=O)[O-])C.[K+] |
Computed by PubChem (NCBI)