cas: 133-05-1 — see every product listed under this CAS number, including other names
rel-(1R,3aR,4S,6aR)-1,4-Bis(benzo[d][1,3]dioxol-5-yl)tetrahydro-1H,3H-furo[3,4-c]furan, 98% (CAS 133-05-1) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Chemat, BLDpharm.
| brand | Chemat |
|---|---|
| catalog number | Ch1122HM-50mg |
| cas | 133-05-1 |
| size | 50mg |
| availability | 5g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 813.20 Pln | |
| Chemat | 100mg | 1336.40 Pln | |
| Chemat | 250mg | 2229.20 Pln | |
| Chemat | 1g | 5906.00 Pln | |
| BLDpharm | 50mg | 830.84 Pln | |
| BLDpharm | 100mg | 1358.44 Pln | |
| BLDpharm | 250mg | 2263.67 Pln | |
| BLDpharm | 1g | 5979.03 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
5-[(3R,3aR,6S,6aR)-3-(1,3-benzodioxol-5-yl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-6-yl]-1,3-benzodioxole (CAS 133-05-1) is a chemical compound with the molecular formula C20H18O6 and a molecular weight of 354.4 g/mol. IUPAC name: 5-[(3R,3aR,6S,6aR)-3-(1,3-benzodioxol-5-yl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-6-yl]-1,3-benzodioxole. InChIKey: PEYUIKBAABKQKQ-WZBLMQSHSA-N.
| Molecular formula | C20H18O6 |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | 5-[(3R,3aR,6S,6aR)-3-(1,3-benzodioxol-5-yl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-6-yl]-1,3-benzodioxole |
| InChIKey | PEYUIKBAABKQKQ-WZBLMQSHSA-N |
| SMILES | C1[C@H]2[C@H](CO[C@@H]2C3=CC4=C(C=C3)OCO4)[C@@H](O1)C5=CC6=C(C=C5)OCO6 |
Computed by PubChem (NCBI)