cas: 6028-28-0 — see every product listed under this CAS number, including other names
rel-(2S,3R)-2-Amino-3-hydroxybutanoic acid hemihydrate, 98%+,RG, 98%+,RG (CAS 6028-28-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IAOD-5g |
| cas | 6028-28-0 |
| size | 5g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 93.20 Pln | |
| Chemat | 25g | 126.80 Pln |
| purity | 98%+,RG |
|---|---|
| delivery time | 3 weeks |
Bis((2S,3R)-2-amino-3-hydroxybutanoic acid);hydrate (CAS 6028-28-0) is a chemical compound with the molecular formula C8H20N2O7 and a molecular weight of 256.25 g/mol. IUPAC name: bis((2S,3R)-2-amino-3-hydroxybutanoic acid);hydrate. InChIKey: QMWHMAPAPXBPFN-PZXRSRGQSA-N.
| Molecular formula | C8H20N2O7 |
|---|---|
| Molecular weight | 256.25 g/mol |
| IUPAC name | bis((2S,3R)-2-amino-3-hydroxybutanoic acid);hydrate |
| InChIKey | QMWHMAPAPXBPFN-PZXRSRGQSA-N |
| SMILES | C[C@H]([C@@H](C(=O)O)N)O.C[C@H]([C@@H](C(=O)O)N)O.O |
Computed by PubChem (NCBI)