cas: 955028-93-0 — see every product listed under this CAS number, including other names
rel-(3R,4S)-tert-Butyl 4-hydroxy-3-methylpiperidine-1-carboxylate 97% (CAS 955028-93-0) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1258625-50mg |
| cas | 955028-93-0 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 776.44 Pln | |
| Ambeed | 100mg | 921.06 Pln | |
| Ambeed | 250mg | 1215.88 Pln | |
| Ambeed | 1g | 2895.75 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1258625 |
Tert-butyl (3R,4S)-4-hydroxy-3-methylpiperidine-1-carboxylate (CAS 955028-93-0) is a chemical compound with the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. IUPAC name: tert-butyl (3R,4S)-4-hydroxy-3-methylpiperidine-1-carboxylate. InChIKey: PSDMSGJMWVMEMV-BDAKNGLRSA-N.
| Molecular formula | C11H21NO3 |
|---|---|
| Molecular weight | 215.29 g/mol |
| IUPAC name | tert-butyl (3R,4S)-4-hydroxy-3-methylpiperidine-1-carboxylate |
| InChIKey | PSDMSGJMWVMEMV-BDAKNGLRSA-N |
| SMILES | C[C@@H]1CN(CC[C@@H]1O)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)