cas: 310480-85-4 — see every product listed under this CAS number, including other names
t-Butyl 2-(4-bromophenylsulfonamido)ethylcarbamate, 98%, 98% (CAS 310480-85-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1142ZM-250mg |
| cas | 310480-85-4 |
| size | 250mg |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 165.20 Pln | |
| Chemat | 1g | 261.20 Pln | |
| Chemat | 5g | 467.60 Pln | |
| Chemat | 25g | 1274.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-[2-[(4-bromophenyl)sulfonylamino]ethyl]carbamate (CAS 310480-85-4) is a chemical compound with the molecular formula C13H19BrN2O4S and a molecular weight of 379.27 g/mol. IUPAC name: tert-butyl N-[2-[(4-bromophenyl)sulfonylamino]ethyl]carbamate. InChIKey: NBFPYRUCEUVPFK-UHFFFAOYSA-N.
| Molecular formula | C13H19BrN2O4S |
|---|---|
| Molecular weight | 379.27 g/mol |
| IUPAC name | tert-butyl N-[2-[(4-bromophenyl)sulfonylamino]ethyl]carbamate |
| InChIKey | NBFPYRUCEUVPFK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCNS(=O)(=O)C1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)