cas: 954268-81-6 — see every product listed under this CAS number, including other names
t-Butyl 2-aminobenzenesulfonamide, 98%, 98% (CAS 954268-81-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IJ5H-100mg |
| cas | 954268-81-6 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 141.20 Pln | |
| Chemat | 250mg | 194.00 Pln | |
| Chemat | 5g | 707.60 Pln | |
| Chemat | 10g | 1355.60 Pln | |
| Chemat | 25g | 2507.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-amino-N-tert-butylbenzenesulfonamide (CAS 954268-81-6) is a chemical compound with the molecular formula C10H16N2O2S and a molecular weight of 228.31 g/mol. IUPAC name: 2-amino-N-tert-butylbenzenesulfonamide. InChIKey: ILPLPDHFRANPRK-UHFFFAOYSA-N.
| Molecular formula | C10H16N2O2S |
|---|---|
| Molecular weight | 228.31 g/mol |
| IUPAC name | 2-amino-N-tert-butylbenzenesulfonamide |
| InChIKey | ILPLPDHFRANPRK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NS(=O)(=O)C1=CC=CC=C1N |
Computed by PubChem (NCBI)