cas: 1330069-67-4 — see every product listed under this CAS number, including other names
tert-Butyl ((1R,2S)-2-hydroxycyclopentyl)carbamate 98% (CAS 1330069-67-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A734935-100mg |
| cas | 1330069-67-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 498.31 Pln | |
| Ambeed | 250mg | 642.94 Pln | |
| Ambeed | 1g | 1505.12 Pln | |
| Ambeed | 5g | 4380.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A734935 |
Tert-butyl N-[(1R,2S)-2-hydroxycyclopentyl]carbamate (CAS 1330069-67-4) is a chemical compound with the molecular formula C10H19NO3 and a molecular weight of 201.26 g/mol. IUPAC name: tert-butyl N-[(1R,2S)-2-hydroxycyclopentyl]carbamate. InChIKey: CGZQRJSADXRRKN-SFYZADRCSA-N.
| Molecular formula | C10H19NO3 |
|---|---|
| Molecular weight | 201.26 g/mol |
| IUPAC name | tert-butyl N-[(1R,2S)-2-hydroxycyclopentyl]carbamate |
| InChIKey | CGZQRJSADXRRKN-SFYZADRCSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCC[C@@H]1O |
Computed by PubChem (NCBI)