CAS 1400808-13-0 appears in our catalog under these names: tert-Butyl (1R,4R,5R)-2-azabicyclo(2.2.1)heptan-5-ylcarbamate, 95%, tert–Butyl (1R，4R，5R)–2–azabicyclo(2·2·1)heptan–5–ylcarbamate. Offered by: AmBeed, GLPBio. Available pack sizes: 5g, 1g, 50mg.
Tert-butyl N-[(1R,4R,5R)-2-azabicyclo[2.2.1]heptan-5-yl]carbamate (CAS 1400808-13-0) is a chemical compound with the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. IUPAC name: tert-butyl N-[(1R,4R,5R)-2-azabicyclo[2.2.1]heptan-5-yl]carbamate. InChIKey: VERHYGQTHIOMQC-IWSPIJDZSA-N.
| Molecular formula | C11H20N2O2 |
|---|---|
| Molecular weight | 212.29 g/mol |
| IUPAC name | tert-butyl N-[(1R,4R,5R)-2-azabicyclo[2.2.1]heptan-5-yl]carbamate |
| InChIKey | VERHYGQTHIOMQC-IWSPIJDZSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1C[C@H]2C[C@@H]1CN2 |
Computed by PubChem (NCBI)