CAS 145106-43-0 appears in our catalog under these names: (1S,2S)–trans–N–Boc–2–aminocyclopentanol, tert-Butyl ((1S,2S)-2-hydroxycyclopentyl)carbamate, 95%. Offered by: GLPBio, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 10g, 25g, 100g.
Tert-butyl N-[(1S,2S)-2-hydroxycyclopentyl]carbamate (CAS 145106-43-0) is a chemical compound with the molecular formula C10H19NO3 and a molecular weight of 201.26 g/mol. IUPAC name: tert-butyl N-[(1S,2S)-2-hydroxycyclopentyl]carbamate. InChIKey: CGZQRJSADXRRKN-YUMQZZPRSA-N.
| Molecular formula | C10H19NO3 |
|---|---|
| Molecular weight | 201.26 g/mol |
| IUPAC name | tert-butyl N-[(1S,2S)-2-hydroxycyclopentyl]carbamate |
| InChIKey | CGZQRJSADXRRKN-YUMQZZPRSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCC[C@@H]1O |
Computed by PubChem (NCBI)