cas: 154737-89-0 — see every product listed under this CAS number, including other names
tert-Butyl ((1S,3S)-3-hydroxycyclopentyl)carbamate, 97%, 97% (CAS 154737-89-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118FQB-100mg |
| cas | 154737-89-0 |
| size | 100mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 122.00 Pln | |
| Chemat | 250mg | 136.40 Pln | |
| Chemat | 500mg | 189.20 Pln | |
| Chemat | 1g | 270.80 Pln | |
| Chemat | 5g | 1086.80 Pln | |
| Chemat | 25g | 4106.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-[(1S,3S)-3-hydroxycyclopentyl]carbamate (CAS 154737-89-0) is a chemical compound with the molecular formula C10H19NO3 and a molecular weight of 201.26 g/mol. IUPAC name: tert-butyl N-[(1S,3S)-3-hydroxycyclopentyl]carbamate. InChIKey: SBUKINULYZANSP-YUMQZZPRSA-N.
| Molecular formula | C10H19NO3 |
|---|---|
| Molecular weight | 201.26 g/mol |
| IUPAC name | tert-butyl N-[(1S,3S)-3-hydroxycyclopentyl]carbamate |
| InChIKey | SBUKINULYZANSP-YUMQZZPRSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CC[C@@H](C1)O |
Computed by PubChem (NCBI)