cas: 213388-72-8 — see every product listed under this CAS number, including other names
tert-Butyl ((3S,4S)-4-fluoropyrrolidin-3-yl)carbamate, 97%, 97% (CAS 213388-72-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BHRX-100mg |
| cas | 213388-72-8 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 942.80 Pln | |
| Chemat | 250mg | 1547.60 Pln | |
| Chemat | 500mg | 2661.20 Pln | |
| Chemat | 1g | 3822.80 Pln | |
| Chemat | 5g | 11205.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-[(3S,4S)-4-fluoropyrrolidin-3-yl]carbamate (CAS 213388-72-8) is a chemical compound with the molecular formula C9H17FN2O2 and a molecular weight of 204.24 g/mol. IUPAC name: tert-butyl N-[(3S,4S)-4-fluoropyrrolidin-3-yl]carbamate. InChIKey: BZSDDSIFAGBZLT-BQBZGAKWSA-N.
| Molecular formula | C9H17FN2O2 |
|---|---|
| Molecular weight | 204.24 g/mol |
| IUPAC name | tert-butyl N-[(3S,4S)-4-fluoropyrrolidin-3-yl]carbamate |
| InChIKey | BZSDDSIFAGBZLT-BQBZGAKWSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CNC[C@@H]1F |
Computed by PubChem (NCBI)