cas: 219862-14-3 — see every product listed under this CAS number, including other names
tert-Butyl (1,2,3,4-tetrahydroquinolin-3-yl)carbamate, 97%, 97% (CAS 219862-14-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch117Y89-100mg |
| cas | 219862-14-3 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 155.60 Pln | |
| Chemat | 250mg | 203.60 Pln | |
| Chemat | 1g | 352.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-(1,2,3,4-tetrahydroquinolin-3-yl)carbamate (CAS 219862-14-3) is a chemical compound with the molecular formula C14H20N2O2 and a molecular weight of 248.32 g/mol. IUPAC name: tert-butyl N-(1,2,3,4-tetrahydroquinolin-3-yl)carbamate. InChIKey: GAURNOYXRZQBNV-UHFFFAOYSA-N.
| Molecular formula | C14H20N2O2 |
|---|---|
| Molecular weight | 248.32 g/mol |
| IUPAC name | tert-butyl N-(1,2,3,4-tetrahydroquinolin-3-yl)carbamate |
| InChIKey | GAURNOYXRZQBNV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1CC2=CC=CC=C2NC1 |
Computed by PubChem (NCBI)