cas: 848500-12-9 — see every product listed under this CAS number, including other names
tert-Butyl (1-(6-bromopyridin-2-yl)piperidin-4-yl)carbamate (CAS 848500-12-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11G8CX-100mg |
| cas | 848500-12-9 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 400.40 Pln | |
| Chemat | 250mg | 602.00 Pln |
| delivery time | 3 weeks |
|---|
Tert-butyl N-[1-(6-bromo-2-pyridinyl)piperidin-4-yl]carbamate (CAS 848500-12-9) is a chemical compound with the molecular formula C15H22BrN3O2 and a molecular weight of 356.26 g/mol. IUPAC name: tert-butyl N-[1-(6-bromo-2-pyridinyl)piperidin-4-yl]carbamate. InChIKey: YMUBXPARJNDDLT-UHFFFAOYSA-N.
| Molecular formula | C15H22BrN3O2 |
|---|---|
| Molecular weight | 356.26 g/mol |
| IUPAC name | tert-butyl N-[1-(6-bromo-2-pyridinyl)piperidin-4-yl]carbamate |
| InChIKey | YMUBXPARJNDDLT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1CCN(CC1)C2=NC(=CC=C2)Br |
Computed by PubChem (NCBI)