cas: 1142211-17-3 — see every product listed under this CAS number, including other names
tert-Butyl (1-(hydroxymethyl)cyclobutyl)carbamate, 97%, 97% (CAS 1142211-17-3) is a chemical reagent available from Chemat. Available pack sizes: 250g, 50mg, 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111AV7-250g |
| cas | 1142211-17-3 |
| size | 250g |
| availability | 1000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 250g | 3746.00 Pln | |
| Chemat | 50mg | 83.60 Pln | |
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 136.40 Pln | |
| Chemat | 5g | 309.20 Pln | |
| Chemat | 10g | 510.80 Pln | |
| Chemat | 25g | 904.40 Pln | |
| Chemat | 50g | 1595.60 Pln | |
| Chemat | 100g | 3126.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-[1-(hydroxymethyl)cyclobutyl]carbamate (CAS 1142211-17-3) is a chemical compound with the molecular formula C10H19NO3 and a molecular weight of 201.26 g/mol. IUPAC name: tert-butyl N-[1-(hydroxymethyl)cyclobutyl]carbamate. InChIKey: CLRGYDRXIYIAHC-UHFFFAOYSA-N.
| Molecular formula | C10H19NO3 |
|---|---|
| Molecular weight | 201.26 g/mol |
| IUPAC name | tert-butyl N-[1-(hydroxymethyl)cyclobutyl]carbamate |
| InChIKey | CLRGYDRXIYIAHC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1(CCC1)CO |
Computed by PubChem (NCBI)