tert-Butyl (10-aminodecyl)carbamate, 97.0%
cas: 216961-61-4 — see every product listed under this CAS number, including other names
tert-Butyl (10-aminodecyl)carbamate, 97.0% (CAS 216961-61-4) is a chemical reagent available from Chemat. Available pack sizes: 10 g, 1 g, 25 g, 5 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W047688-10 g |
| cas | 216961-61-4 |
| size | 10 g |
| availability | In stock |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 10 g | 765.52 Pln | |
| MedChemExpress | 1 g | 287.18 Pln | |
| MedChemExpress | 25 g | 1225.27 Pln | |
| MedChemExpress | 5 g | 584.40 Pln |
properties
| delivery time | 2-3 weeks |
|---|---|
| purity | 97.0% |
Tert-butyl N-(10-aminodecyl)carbamate (CAS 216961-61-4) is a chemical compound with the molecular formula C15H32N2O2 and a molecular weight of 272.43 g/mol. IUPAC name: tert-butyl N-(10-aminodecyl)carbamate. InChIKey: RSAPJHYIFKJREV-UHFFFAOYSA-N.
| Molecular formula | C15H32N2O2 |
|---|---|
| Molecular weight | 272.43 g/mol |
| IUPAC name | tert-butyl N-(10-aminodecyl)carbamate |
| InChIKey | RSAPJHYIFKJREV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCCCCCCCCCN |
Computed by PubChem (NCBI)
Synonyms:
Decane-1,10-diamine, N-BOC protected, tert-Butyl (10-aminodecyl)carbamate, Tert-butyl N-(10-aminodecyl)carbamate, (10-Aminodecyl)-carbamic acid tert-butyl ester, N-Boc-decane-1,10-diamine, 1,10-Diaminodecane, N1-BOC protected, N1-Boc-decane-1,10-diamine, orb3028746, tert-butyl 10-aminodecylcarbamate, RSAPJHYIFKJREV-UHFFFAOYSA-N