cas: 1404111-67-6 — see every product listed under this CAS number, including other names
tert-Butyl (14-hydroxy-3,6,9,12-tetraoxatetradecyl)carbamate, 98%, 98% (CAS 1404111-67-6) is a chemical reagent available from Chemat. Available pack sizes: 250g, 100mg, 250mg, 1g, 5g, 10g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112CDU-250g |
| cas | 1404111-67-6 |
| size | 250g |
| availability | 1000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 250g | 6477.20 Pln | |
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 150.80 Pln | |
| Chemat | 5g | 477.20 Pln | |
| Chemat | 10g | 683.60 Pln | |
| Chemat | 25g | 1302.80 Pln | |
| Chemat | 50g | 2267.60 Pln | |
| Chemat | 100g | 3923.60 Pln | |
| Chemat | 500g | 9868.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethyl]carbamate (CAS 1404111-67-6) is a chemical compound with the molecular formula C15H31NO7 and a molecular weight of 337.41 g/mol. IUPAC name: tert-butyl N-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethyl]carbamate. InChIKey: PBWLVPPLXJCLBC-UHFFFAOYSA-N.
| Molecular formula | C15H31NO7 |
|---|---|
| Molecular weight | 337.41 g/mol |
| IUPAC name | tert-butyl N-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethyl]carbamate |
| InChIKey | PBWLVPPLXJCLBC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCOCCOCCO |
Computed by PubChem (NCBI)