cas: 174885-99-5 — see every product listed under this CAS number, including other names
tert-Butyl (2-amino-2-phenylethyl)carbamate, 97% (CAS 174885-99-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 5g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A647720-100mg |
| cas | 174885-99-5 |
| size | 100mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 100mg | 1228.78 Pln | |
| Fluorochem | 1g | 2543.91 Pln | |
| Fluorochem | 5g | 7339.10 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
Tert-butyl N-(2-amino-2-phenylethyl)carbamate (CAS 174885-99-5) is a chemical compound with the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. IUPAC name: tert-butyl N-(2-amino-2-phenylethyl)carbamate. InChIKey: CLUUDOMFHPDBIR-UHFFFAOYSA-N.
| Molecular formula | C13H20N2O2 |
|---|---|
| Molecular weight | 236.31 g/mol |
| IUPAC name | tert-butyl N-(2-amino-2-phenylethyl)carbamate |
| InChIKey | CLUUDOMFHPDBIR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC(C1=CC=CC=C1)N |
Computed by PubChem (NCBI)