cas: 1314390-34-5 — see every product listed under this CAS number, including other names
tert-Butyl (2-bromopyrimidin-5-yl)carbamate, 98%, 98% (CAS 1314390-34-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111W7F-100mg |
| cas | 1314390-34-5 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 760.40 Pln | |
| Chemat | 250mg | 1298.00 Pln | |
| Chemat | 1g | 3155.60 Pln | |
| Chemat | 5g | 12434.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-(2-bromopyrimidin-5-yl)carbamate (CAS 1314390-34-5) is a chemical compound with the molecular formula C9H12BrN3O2 and a molecular weight of 274.11 g/mol. IUPAC name: tert-butyl N-(2-bromopyrimidin-5-yl)carbamate. InChIKey: DCZMUYVBEYQGFQ-UHFFFAOYSA-N.
| Molecular formula | C9H12BrN3O2 |
|---|---|
| Molecular weight | 274.11 g/mol |
| IUPAC name | tert-butyl N-(2-bromopyrimidin-5-yl)carbamate |
| InChIKey | DCZMUYVBEYQGFQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CN=C(N=C1)Br |
Computed by PubChem (NCBI)