cas: 1379344-91-8 — see every product listed under this CAS number, including other names
tert-Butyl (2-chlorothiazol-5-yl)carbamate 95% (CAS 1379344-91-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A268963-100mg |
| cas | 1379344-91-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 120.06 Pln | |
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 242.44 Pln | |
| Ambeed | 5g | 782.00 Pln | |
| Ambeed | 10g | 1488.44 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A268963 |
Tert-butyl N-(2-chloro-1,3-thiazol-5-yl)carbamate (CAS 1379344-91-8) is a chemical compound with the molecular formula C8H11ClN2O2S and a molecular weight of 234.70 g/mol. IUPAC name: tert-butyl N-(2-chloro-1,3-thiazol-5-yl)carbamate. InChIKey: SERDINDWSVFODE-UHFFFAOYSA-N.
| Molecular formula | C8H11ClN2O2S |
|---|---|
| Molecular weight | 234.70 g/mol |
| IUPAC name | tert-butyl N-(2-chloro-1,3-thiazol-5-yl)carbamate |
| InChIKey | SERDINDWSVFODE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CN=C(S1)Cl |
Computed by PubChem (NCBI)