cas: 133117-97-2 — see every product listed under this CAS number, including other names
tert-Butyl (2-cyanopropan-2-yl)carbamate, 98% (CAS 133117-97-2) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A245949-10g |
| cas | 133117-97-2 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 14033.95 Pln | |
| Fluorochem | 100mg | 419.66 Pln | |
| Fluorochem | 250mg | 659.16 Pln | |
| Fluorochem | 1g | 1372.45 Pln | |
| Fluorochem | 5g | 4006.94 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
Tert-butyl N-(2-cyanopropan-2-yl)carbamate (CAS 133117-97-2) is a chemical compound with the molecular formula C9H16N2O2 and a molecular weight of 184.24 g/mol. IUPAC name: tert-butyl N-(2-cyanopropan-2-yl)carbamate. InChIKey: GIGXCVOTKUOLHM-UHFFFAOYSA-N.
| Molecular formula | C9H16N2O2 |
|---|---|
| Molecular weight | 184.24 g/mol |
| IUPAC name | tert-butyl N-(2-cyanopropan-2-yl)carbamate |
| InChIKey | GIGXCVOTKUOLHM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(C)(C)C#N |
Computed by PubChem (NCBI)