CAS 1219112-94-3 appears in our catalog under these names: 4-(BOC-Amino)picoline, 98%, 4-(BOC-Amino)picoline, 98%, 98%, tert-Butyl (2-methylpyridin-4-yl)carbamate, 98%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 10g, 1g, 5g, 250mg.
Tert-butyl N-(2-methyl-4-pyridinyl)carbamate (CAS 1219112-94-3) is a chemical compound with the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. IUPAC name: tert-butyl N-(2-methyl-4-pyridinyl)carbamate. InChIKey: KWYQHZAEXXBEGZ-UHFFFAOYSA-N.
| Molecular formula | C11H16N2O2 |
|---|---|
| Molecular weight | 208.26 g/mol |
| IUPAC name | tert-butyl N-(2-methyl-4-pyridinyl)carbamate |
| InChIKey | KWYQHZAEXXBEGZ-UHFFFAOYSA-N |
| SMILES | CC1=NC=CC(=C1)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)