cas: 1231755-15-9 — see every product listed under this CAS number, including other names
tert-Butyl (2-oxo-2-((2,2,2-trifluoroethyl)amino)ethyl)carbamate, 98% (CAS 1231755-15-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 100mg, 250mg. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A1182377-1g |
| cas | 1231755-15-9 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 7048.72 Pln | |
| Fluorochem | 100mg | 1320.39 Pln | |
| Fluorochem | 250mg | 2236.73 Pln | |
| Fluorochem | 1g | 4402.63 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
Tert-butyl N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]carbamate (CAS 1231755-15-9) is a chemical compound with the molecular formula C9H15F3N2O3 and a molecular weight of 256.22 g/mol. IUPAC name: tert-butyl N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]carbamate. InChIKey: ZBMUNGIIVQNAFS-UHFFFAOYSA-N.
| Molecular formula | C9H15F3N2O3 |
|---|---|
| Molecular weight | 256.22 g/mol |
| IUPAC name | tert-butyl N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]carbamate |
| InChIKey | ZBMUNGIIVQNAFS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC(=O)NCC(F)(F)F |
Computed by PubChem (NCBI)