cas: 1018818-05-7 — see every product listed under this CAS number, including other names
tert-Butyl (2R,4S)-2-(hydroxymethyl)-4-methylpyrrolidine-1-carboxylate, 97% (CAS 1018818-05-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F609400-100MG |
| cas | 1018818-05-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 2627.22 Pln | |
| Fluorochem | 250mg | 4157.93 Pln | |
| Fluorochem | 500mg | 6875.72 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl (2R,4S)-2-(hydroxymethyl)-4-methylpyrrolidine-1-carboxylate (CAS 1018818-05-7) is a chemical compound with the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. IUPAC name: tert-butyl (2R,4S)-2-(hydroxymethyl)-4-methylpyrrolidine-1-carboxylate. InChIKey: MTGCHOAIXJTLDT-DTWKUNHWSA-N.
| Molecular formula | C11H21NO3 |
|---|---|
| Molecular weight | 215.29 g/mol |
| IUPAC name | tert-butyl (2R,4S)-2-(hydroxymethyl)-4-methylpyrrolidine-1-carboxylate |
| InChIKey | MTGCHOAIXJTLDT-DTWKUNHWSA-N |
| SMILES | C[C@H]1C[C@@H](N(C1)C(=O)OC(C)(C)C)CO |
Computed by PubChem (NCBI)