cas: 1609123-53-6 — see every product listed under this CAS number, including other names
tert-Butyl (2S,4S)-2-cyano-4-hydroxypyrrolidine-1-carboxylate, 98%, 98% (CAS 1609123-53-6) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DY1W-500mg |
| cas | 1609123-53-6 |
| size | 500mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 500mg | 323.60 Pln | |
| Chemat | 100mg | 141.20 Pln | |
| Chemat | 250mg | 203.60 Pln | |
| Chemat | 1g | 386.00 Pln | |
| Chemat | 5g | 1019.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl (2S,4S)-2-cyano-4-hydroxypyrrolidine-1-carboxylate (CAS 1609123-53-6) is a chemical compound with the molecular formula C10H16N2O3 and a molecular weight of 212.25 g/mol. IUPAC name: tert-butyl (2S,4S)-2-cyano-4-hydroxypyrrolidine-1-carboxylate. InChIKey: UNVNZVOSYRUJTH-YUMQZZPRSA-N.
| Molecular formula | C10H16N2O3 |
|---|---|
| Molecular weight | 212.25 g/mol |
| IUPAC name | tert-butyl (2S,4S)-2-cyano-4-hydroxypyrrolidine-1-carboxylate |
| InChIKey | UNVNZVOSYRUJTH-YUMQZZPRSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](C[C@H]1C#N)O |
Computed by PubChem (NCBI)