cas: 1232365-42-2 — see every product listed under this CAS number, including other names
tert-Butyl (3,3-difluoro-1-(hydroxymethyl)cyclobutyl)carbamate 97% (CAS 1232365-42-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A594641-100mg |
| cas | 1232365-42-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 476.06 Pln | |
| Ambeed | 250mg | 592.88 Pln | |
| Ambeed | 1g | 1416.12 Pln | |
| Ambeed | 5g | 4119.50 Pln | |
| Ambeed | 10g | 6589.25 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A594641 |
Tert-butyl N-[3,3-difluoro-1-(hydroxymethyl)cyclobutyl]carbamate (CAS 1232365-42-2) is a chemical compound with the molecular formula C10H17F2NO3 and a molecular weight of 237.24 g/mol. IUPAC name: tert-butyl N-[3,3-difluoro-1-(hydroxymethyl)cyclobutyl]carbamate. InChIKey: RNZVBWMKWVRXIY-UHFFFAOYSA-N.
| Molecular formula | C10H17F2NO3 |
|---|---|
| Molecular weight | 237.24 g/mol |
| IUPAC name | tert-butyl N-[3,3-difluoro-1-(hydroxymethyl)cyclobutyl]carbamate |
| InChIKey | RNZVBWMKWVRXIY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1(CC(C1)(F)F)CO |
Computed by PubChem (NCBI)