cas: 1263180-22-8 — see every product listed under this CAS number, including other names
tert-Butyl (3,3-difluoropiperidin-4-yl)carbamate, 95%, 95% (CAS 1263180-22-8) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111SKD-50mg |
| cas | 1263180-22-8 |
| size | 50mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 126.80 Pln | |
| Chemat | 100mg | 141.20 Pln | |
| Chemat | 250mg | 227.60 Pln | |
| Chemat | 1g | 731.60 Pln | |
| Chemat | 5g | 3222.80 Pln | |
| Chemat | 25g | 11123.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-(3,3-difluoropiperidin-4-yl)carbamate (CAS 1263180-22-8) is a chemical compound with the molecular formula C10H18F2N2O2 and a molecular weight of 236.26 g/mol. IUPAC name: tert-butyl N-(3,3-difluoropiperidin-4-yl)carbamate. InChIKey: BUKXGGNFFUMWRC-UHFFFAOYSA-N.
| Molecular formula | C10H18F2N2O2 |
|---|---|
| Molecular weight | 236.26 g/mol |
| IUPAC name | tert-butyl N-(3,3-difluoropiperidin-4-yl)carbamate |
| InChIKey | BUKXGGNFFUMWRC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1CCNCC1(F)F |
Computed by PubChem (NCBI)