cas: 1802048-91-4 — see every product listed under this CAS number, including other names
tert-Butyl (3-(bromomethyl)oxetan-3-yl)carbamate, 97% (CAS 1802048-91-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F612771-100MG |
| cas | 1802048-91-4 |
| size | 100mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1164.19 Pln | |
| Fluorochem | 250mg | 1794.18 Pln | |
| Fluorochem | 500mg | 2944.81 Pln | |
| Fluorochem | 1g | 4324.54 Pln | |
| Fluorochem | 5g | 12550.81 Pln | |
| Fluorochem | 10g | 19142.24 Pln | |
| Fluorochem | 25g | 30601.74 Pln | |
| BLDpharm | 100mg | 825.29 Pln | |
| BLDpharm | 250mg | 1269.58 Pln | |
| BLDpharm | 1g | 3063.39 Pln |
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
Tert-butyl N-[3-(bromomethyl)oxetan-3-yl]carbamate (CAS 1802048-91-4) is a chemical compound with the molecular formula C9H16BrNO3 and a molecular weight of 266.13 g/mol. IUPAC name: tert-butyl N-[3-(bromomethyl)oxetan-3-yl]carbamate. InChIKey: SEUDVXPZTLKDKT-UHFFFAOYSA-N.
| Molecular formula | C9H16BrNO3 |
|---|---|
| Molecular weight | 266.13 g/mol |
| IUPAC name | tert-butyl N-[3-(bromomethyl)oxetan-3-yl]carbamate |
| InChIKey | SEUDVXPZTLKDKT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1(COC1)CBr |
Computed by PubChem (NCBI)