cas: 134574-96-2 — see every product listed under this CAS number, including other names
tert-Butyl (3-azabicyclo[3.1.0]hexan-1-ylmethyl)carbamate, 98% (CAS 134574-96-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F432182-100MG |
| cas | 134574-96-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 320.74 Pln | |
| Fluorochem | 250mg | 456.11 Pln | |
| Fluorochem | 500mg | 669.57 Pln | |
| Fluorochem | 1g | 1096.51 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl N-(3-azabicyclo[3.1.0]hexan-1-ylmethyl)carbamate (CAS 134574-96-2) is a chemical compound with the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. IUPAC name: tert-butyl N-(3-azabicyclo[3.1.0]hexan-1-ylmethyl)carbamate. InChIKey: UIYMGRQQGQOESZ-UHFFFAOYSA-N.
| Molecular formula | C11H20N2O2 |
|---|---|
| Molecular weight | 212.29 g/mol |
| IUPAC name | tert-butyl N-(3-azabicyclo[3.1.0]hexan-1-ylmethyl)carbamate |
| InChIKey | UIYMGRQQGQOESZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC12CC1CNC2 |
Computed by PubChem (NCBI)