cas: 1205749-14-9 — see every product listed under this CAS number, including other names
tert-Butyl (3-ethylazetidin-3-yl)carbamate, 98+% (CAS 1205749-14-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 100mg, 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A755096-5g |
| cas | 1205749-14-9 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 17061.10 Pln | |
| AmBeed | 10g | 28395.01 Pln | |
| AmBeed | 100mg | 1489.18 Pln | |
| AmBeed | 1g | 5733.70 Pln |
| purity | 98+% |
|---|---|
| delivery time | To be confirmed by Chemat |
Tert-butyl N-(3-ethylazetidin-3-yl)carbamate (CAS 1205749-14-9) is a chemical compound with the molecular formula C10H20N2O2 and a molecular weight of 200.28 g/mol. IUPAC name: tert-butyl N-(3-ethylazetidin-3-yl)carbamate. InChIKey: SLINLQRBGQBQHK-UHFFFAOYSA-N.
| Molecular formula | C10H20N2O2 |
|---|---|
| Molecular weight | 200.28 g/mol |
| IUPAC name | tert-butyl N-(3-ethylazetidin-3-yl)carbamate |
| InChIKey | SLINLQRBGQBQHK-UHFFFAOYSA-N |
| SMILES | CCC1(CNC1)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)