cas: 262433-29-4 — see every product listed under this CAS number, including other names
tert-Butyl (3-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)carbamate, 96%, 96% (CAS 262433-29-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12EKYN-100mg |
| cas | 262433-29-4 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1749.20 Pln | |
| Chemat | 250mg | 2464.40 Pln | |
| Chemat | 1g | 4922.00 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-[3-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate (CAS 262433-29-4) is a chemical compound with the molecular formula C18H28BNO5 and a molecular weight of 349.2 g/mol. IUPAC name: tert-butyl N-[3-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate. InChIKey: XZDFUAVQCGKNHS-UHFFFAOYSA-N.
| Molecular formula | C18H28BNO5 |
|---|---|
| Molecular weight | 349.2 g/mol |
| IUPAC name | tert-butyl N-[3-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate |
| InChIKey | XZDFUAVQCGKNHS-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)NC(=O)OC(C)(C)C)OC |
Computed by PubChem (NCBI)