cas: 1821799-48-7 — see every product listed under this CAS number, including other names
tert-Butyl (3R,4S)-4-amino-3-hydroxypiperidine-1-carboxylate, 97%, 97% (CAS 1821799-48-7) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DUDG-10g |
| cas | 1821799-48-7 |
| size | 10g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 8973.20 Pln | |
| Chemat | 100mg | 477.20 Pln | |
| Chemat | 250mg | 717.20 Pln | |
| Chemat | 1g | 1374.80 Pln | |
| Chemat | 5g | 5632.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl (3R,4S)-4-amino-3-hydroxypiperidine-1-carboxylate (CAS 1821799-48-7) is a chemical compound with the molecular formula C10H20N2O3 and a molecular weight of 216.28 g/mol. IUPAC name: tert-butyl (3R,4S)-4-amino-3-hydroxypiperidine-1-carboxylate. InChIKey: KREUZCYJWPQPJX-JGVFFNPUSA-N.
| Molecular formula | C10H20N2O3 |
|---|---|
| Molecular weight | 216.28 g/mol |
| IUPAC name | tert-butyl (3R,4S)-4-amino-3-hydroxypiperidine-1-carboxylate |
| InChIKey | KREUZCYJWPQPJX-JGVFFNPUSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H]([C@@H](C1)O)N |
Computed by PubChem (NCBI)