cas: 1052713-53-7 — see every product listed under this CAS number, including other names
tert-Butyl (4,4-difluoropiperidin-3-yl)carbamate 98% (CAS 1052713-53-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A298072-100mg |
| cas | 1052713-53-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 498.31 Pln | |
| Ambeed | 250mg | 748.62 Pln | |
| Ambeed | 1g | 1916.75 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A298072 |
Tert-butyl N-(4,4-difluoropiperidin-3-yl)carbamate (CAS 1052713-53-7) is a chemical compound with the molecular formula C10H18F2N2O2 and a molecular weight of 236.26 g/mol. IUPAC name: tert-butyl N-(4,4-difluoropiperidin-3-yl)carbamate. InChIKey: PQJOHBZTOIMHCM-UHFFFAOYSA-N.
| Molecular formula | C10H18F2N2O2 |
|---|---|
| Molecular weight | 236.26 g/mol |
| IUPAC name | tert-butyl N-(4,4-difluoropiperidin-3-yl)carbamate |
| InChIKey | PQJOHBZTOIMHCM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1CNCCC1(F)F |
Computed by PubChem (NCBI)