cas: 1393442-28-8 — see every product listed under this CAS number, including other names
tert-Butyl (4-bromo-2-(trifluoromethyl)phenyl)carbamate, 98%, 98% (CAS 1393442-28-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110GDK-100mg |
| cas | 1393442-28-8 |
| size | 100mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 112.40 Pln | |
| Chemat | 250mg | 141.20 Pln | |
| Chemat | 1g | 261.20 Pln | |
| Chemat | 5g | 707.60 Pln | |
| Chemat | 10g | 1149.20 Pln | |
| Chemat | 25g | 2243.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-[4-bromo-2-(trifluoromethyl)phenyl]carbamate (CAS 1393442-28-8) is a chemical compound with the molecular formula C12H13BrF3NO2 and a molecular weight of 340.14 g/mol. IUPAC name: tert-butyl N-[4-bromo-2-(trifluoromethyl)phenyl]carbamate. InChIKey: CPPNUIOGCQEMOY-UHFFFAOYSA-N.
| Molecular formula | C12H13BrF3NO2 |
|---|---|
| Molecular weight | 340.14 g/mol |
| IUPAC name | tert-butyl N-[4-bromo-2-(trifluoromethyl)phenyl]carbamate |
| InChIKey | CPPNUIOGCQEMOY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(C=C(C=C1)Br)C(F)(F)F |
Computed by PubChem (NCBI)