cas: 1449135-41-4 — see every product listed under this CAS number, including other names
tert-Butyl (4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)carbamate 98% (CAS 1449135-41-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A467334-250mg |
| cas | 1449135-41-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 325.88 Pln | |
| Ambeed | 1g | 620.69 Pln | |
| Ambeed | 5g | 1911.19 Pln | |
| Ambeed | 25g | 6661.56 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A467334 |
Tert-butyl N-[4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate (CAS 1449135-41-4) is a chemical compound with the molecular formula C17H25BFNO4 and a molecular weight of 337.2 g/mol. IUPAC name: tert-butyl N-[4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate. InChIKey: JWYMEKZRPHNWGS-UHFFFAOYSA-N.
| Molecular formula | C17H25BFNO4 |
|---|---|
| Molecular weight | 337.2 g/mol |
| IUPAC name | tert-butyl N-[4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate |
| InChIKey | JWYMEKZRPHNWGS-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)NC(=O)OC(C)(C)C)F |
Computed by PubChem (NCBI)