cas: 2377609-03-3 — see every product listed under this CAS number, including other names
tert-Butyl (4-nitro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzyl)carbamate 97% (CAS 2377609-03-3) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1616855-50mg |
| cas | 2377609-03-3 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 498.31 Pln | |
| Ambeed | 100mg | 587.31 Pln | |
| Ambeed | 250mg | 876.56 Pln | |
| Ambeed | 1g | 2089.19 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1616855 |
Tert-butyl N-[[4-nitro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]carbamate (CAS 2377609-03-3) is a chemical compound with the molecular formula C18H27BN2O6 and a molecular weight of 378.2 g/mol. IUPAC name: tert-butyl N-[[4-nitro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]carbamate. InChIKey: OQACYEPDPVVQRH-UHFFFAOYSA-N.
| Molecular formula | C18H27BN2O6 |
|---|---|
| Molecular weight | 378.2 g/mol |
| IUPAC name | tert-butyl N-[[4-nitro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]carbamate |
| InChIKey | OQACYEPDPVVQRH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)[N+](=O)[O-])CNC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)