cas: 1820679-70-6 — see every product listed under this CAS number, including other names
tert-Butyl (4R)-4-amino-3,3-difluoropiperidine-1-carboxylate, 98%, 98% (CAS 1820679-70-6) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g, 5g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1134CB-50mg |
| cas | 1820679-70-6 |
| size | 50mg |
| availability | 100g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 338.00 Pln | |
| Chemat | 100mg | 405.20 Pln | |
| Chemat | 250mg | 578.00 Pln | |
| Chemat | 500mg | 837.20 Pln | |
| Chemat | 1g | 1096.40 Pln | |
| Chemat | 5g | 2128.40 Pln | |
| Chemat | 25g | 3006.80 Pln | |
| Chemat | 50g | 5589.20 Pln | |
| Chemat | 100g | 8915.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl (4R)-4-amino-3,3-difluoropiperidine-1-carboxylate (CAS 1820679-70-6) is a chemical compound with the molecular formula C10H18F2N2O2 and a molecular weight of 236.26 g/mol. IUPAC name: tert-butyl (4R)-4-amino-3,3-difluoropiperidine-1-carboxylate. InChIKey: APZOOTJWPGQYSZ-SSDOTTSWSA-N.
| Molecular formula | C10H18F2N2O2 |
|---|---|
| Molecular weight | 236.26 g/mol |
| IUPAC name | tert-butyl (4R)-4-amino-3,3-difluoropiperidine-1-carboxylate |
| InChIKey | APZOOTJWPGQYSZ-SSDOTTSWSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](C(C1)(F)F)N |
Computed by PubChem (NCBI)