cas: 910462-31-6 — see every product listed under this CAS number, including other names
tert-Butyl (5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-yl)carbamate, 97% (CAS 910462-31-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F230726-1G |
| cas | 910462-31-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 154.13 Pln | |
| Fluorochem | 5g | 341.56 Pln | |
| Fluorochem | 25g | 1476.58 Pln | |
| Fluorochem | 100g | 4892.05 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]carbamate (CAS 910462-31-6) is a chemical compound with the molecular formula C16H25BN2O4 and a molecular weight of 320.2 g/mol. IUPAC name: tert-butyl N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]carbamate. InChIKey: USZVCDRKIVKICD-UHFFFAOYSA-N.
| Molecular formula | C16H25BN2O4 |
|---|---|
| Molecular weight | 320.2 g/mol |
| IUPAC name | tert-butyl N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]carbamate |
| InChIKey | USZVCDRKIVKICD-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(C=C2)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)