tert-Butyl (5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiazol-2-yl)((2-(trimethylsilyl)ethoxy)methyl)carbamate, 98%
cas: 1228356-82-8 — see every product listed under this CAS number, including other names
tert-Butyl (5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiazol-2-yl)((2-(trimethylsilyl)ethoxy)methyl)carbamate, 98% (CAS 1228356-82-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1541666-100mg |
| cas | 1228356-82-8 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 559.50 Pln | |
| Ambeed | 250mg | 854.31 Pln | |
| Ambeed | 1g | 2144.81 Pln | |
| Ambeed | 5g | 7329.06 Pln | |
| Chemat | 100mg | 434.00 Pln | |
| Chemat | 250mg | 659.60 Pln | |
| Chemat | 1g | 1614.80 Pln | |
| Chemat | 5g | 5493.20 Pln | |
| BLDpharm | 100mg | 553.16 Pln | |
| BLDpharm | 250mg | 841.95 Pln | |
| BLDpharm | 1g | 2102.62 Pln | |
| BLDpharm | 5g | 7184.16 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
Tert-butyl N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]-N-(2-trimethylsilylethoxymethyl)carbamate (CAS 1228356-82-8) is a chemical compound with the molecular formula C20H37BN2O5SSi and a molecular weight of 456.5 g/mol. IUPAC name: tert-butyl N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]-N-(2-trimethylsilylethoxymethyl)carbamate. InChIKey: HBNMLZWVAOSFSG-UHFFFAOYSA-N.
| Molecular formula | C20H37BN2O5SSi |
|---|---|
| Molecular weight | 456.5 g/mol |
| IUPAC name | tert-butyl N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]-N-(2-trimethylsilylethoxymethyl)carbamate |
| InChIKey | HBNMLZWVAOSFSG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(S2)N(COCC[Si](C)(C)C)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)