cas: 304873-96-9 — see every product listed under this CAS number, including other names
tert-Butyl (5-(bromomethyl)pyridin-2-yl)carbamate, 97% (CAS 304873-96-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F232099-100MG |
| cas | 304873-96-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 357.18 Pln | |
| Fluorochem | 250mg | 560.24 Pln | |
| Fluorochem | 1g | 1341.21 Pln | |
| Fluorochem | 5g | 4595.27 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl N-[5-(bromomethyl)-2-pyridinyl]carbamate (CAS 304873-96-9) is a chemical compound with the molecular formula C11H15BrN2O2 and a molecular weight of 287.15 g/mol. IUPAC name: tert-butyl N-[5-(bromomethyl)-2-pyridinyl]carbamate. InChIKey: JKBGHFXEMZZLFY-UHFFFAOYSA-N.
| Molecular formula | C11H15BrN2O2 |
|---|---|
| Molecular weight | 287.15 g/mol |
| IUPAC name | tert-butyl N-[5-(bromomethyl)-2-pyridinyl]carbamate |
| InChIKey | JKBGHFXEMZZLFY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=NC=C(C=C1)CBr |
Computed by PubChem (NCBI)