cas: 364631-72-1 — see every product listed under this CAS number, including other names
tert-Butyl (5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl)carbamate, 97%, 97% (CAS 364631-72-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12AR6I-100mg |
| cas | 364631-72-1 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 434.00 Pln | |
| Chemat | 250mg | 683.60 Pln | |
| Chemat | 1g | 1509.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]carbamate (CAS 364631-72-1) is a chemical compound with the molecular formula C12H23NO5 and a molecular weight of 261.31 g/mol. IUPAC name: tert-butyl N-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]carbamate. InChIKey: UIDPKGWXTKYSPZ-UHFFFAOYSA-N.
| Molecular formula | C12H23NO5 |
|---|---|
| Molecular weight | 261.31 g/mol |
| IUPAC name | tert-butyl N-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]carbamate |
| InChIKey | UIDPKGWXTKYSPZ-UHFFFAOYSA-N |
| SMILES | CC1(OCC(CO1)(CO)NC(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)