cas: 914349-79-4 — see every product listed under this CAS number, including other names
tert-Butyl (5-bromopyrazin-2-yl)carbamate 98% (CAS 914349-79-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A155925-100mg |
| cas | 914349-79-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 209.06 Pln | |
| Ambeed | 250mg | 264.69 Pln | |
| Ambeed | 1g | 359.25 Pln | |
| Ambeed | 5g | 1010.06 Pln | |
| Ambeed | 10g | 1744.31 Pln | |
| Ambeed | 25g | 3185.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A155925 |
Tert-butyl N-(5-bromopyrazin-2-yl)carbamate (CAS 914349-79-4) is a chemical compound with the molecular formula C9H12BrN3O2 and a molecular weight of 274.11 g/mol. IUPAC name: tert-butyl N-(5-bromopyrazin-2-yl)carbamate. InChIKey: PNYUSBALYDXDRK-UHFFFAOYSA-N.
| Molecular formula | C9H12BrN3O2 |
|---|---|
| Molecular weight | 274.11 g/mol |
| IUPAC name | tert-butyl N-(5-bromopyrazin-2-yl)carbamate |
| InChIKey | PNYUSBALYDXDRK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CN=C(C=N1)Br |
Computed by PubChem (NCBI)