cas: 227939-01-7 — see every product listed under this CAS number, including other names
tert-Butyl (5-bromopyridin-2-yl)(methyl)carbamate, 98+%, 98+% (CAS 227939-01-7) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BGXN-25g |
| cas | 227939-01-7 |
| size | 25g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25g | 4202.00 Pln | |
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 227.60 Pln | |
| Chemat | 5g | 890.00 Pln |
| purity | 98+% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-(5-bromo-2-pyridinyl)-N-methylcarbamate (CAS 227939-01-7) is a chemical compound with the molecular formula C11H15BrN2O2 and a molecular weight of 287.15 g/mol. IUPAC name: tert-butyl N-(5-bromo-2-pyridinyl)-N-methylcarbamate. InChIKey: YHTZSPWLJTZRDM-UHFFFAOYSA-N.
| Molecular formula | C11H15BrN2O2 |
|---|---|
| Molecular weight | 287.15 g/mol |
| IUPAC name | tert-butyl N-(5-bromo-2-pyridinyl)-N-methylcarbamate |
| InChIKey | YHTZSPWLJTZRDM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C)C1=NC=C(C=C1)Br |
Computed by PubChem (NCBI)