cas: 209959-28-4 — see every product listed under this CAS number, including other names
tert-Butyl (5-bromopyridin-2-yl)(tert-butoxycarbonyl)carbamate 98% (CAS 209959-28-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A652338-100mg |
| cas | 209959-28-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 292.50 Pln | |
| Ambeed | 250mg | 375.94 Pln | |
| Ambeed | 1g | 670.75 Pln | |
| Ambeed | 5g | 2372.88 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A652338 |
Tert-butyl N-(5-bromo-2-pyridinyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate (CAS 209959-28-4) is a chemical compound with the molecular formula C15H21BrN2O4 and a molecular weight of 373.24 g/mol. IUPAC name: tert-butyl N-(5-bromo-2-pyridinyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate. InChIKey: AVJZDKRYPXHWDM-UHFFFAOYSA-N.
| Molecular formula | C15H21BrN2O4 |
|---|---|
| Molecular weight | 373.24 g/mol |
| IUPAC name | tert-butyl N-(5-bromo-2-pyridinyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
| InChIKey | AVJZDKRYPXHWDM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C1=NC=C(C=C1)Br)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)