cas: 90101-22-7 — see every product listed under this CAS number, including other names
tert-Butyl (6-methylpyridin-2-yl)carbamate, 98% (CAS 90101-22-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F091657-5G |
| cas | 90101-22-7 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 216.61 Pln | |
| Fluorochem | 10g | 351.98 Pln | |
| Fluorochem | 25g | 737.26 Pln | |
| Fluorochem | 100g | 2387.72 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
Tert-butyl N-(6-methyl-2-pyridinyl)carbamate (CAS 90101-22-7) is a chemical compound with the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. IUPAC name: tert-butyl N-(6-methyl-2-pyridinyl)carbamate. InChIKey: XSVAARVWQDEAEL-UHFFFAOYSA-N.
| Molecular formula | C11H16N2O2 |
|---|---|
| Molecular weight | 208.26 g/mol |
| IUPAC name | tert-butyl N-(6-methyl-2-pyridinyl)carbamate |
| InChIKey | XSVAARVWQDEAEL-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CC=C1)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)