tert-Butyl (7-bromopyrrolo[2,1-f][1,2,4]triazin-4-yl)carbamate, 95%
cas: 2328091-01-4 — see every product listed under this CAS number, including other names
tert-Butyl (7-bromopyrrolo[2,1-f][1,2,4]triazin-4-yl)carbamate, 95% (CAS 2328091-01-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1481196-250mg |
| cas | 2328091-01-4 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 264.69 Pln | |
| Ambeed | 1g | 403.75 Pln | |
| Ambeed | 5g | 1115.75 Pln | |
| BLDpharm | 250mg | 253.27 Pln | |
| BLDpharm | 1g | 430.98 Pln | |
| BLDpharm | 5g | 1197.38 Pln | |
| Chemat | 250mg | 208.40 Pln | |
| Chemat | 1g | 443.60 Pln | |
| Fluorochem | 1g | 804.94 Pln | |
| Fluorochem | 250mg | 362.39 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
Tert-butyl N-(7-bromopyrrolo[2,1-f][1,2,4]triazin-4-yl)carbamate (CAS 2328091-01-4) is a chemical compound with the molecular formula C11H13BrN4O2 and a molecular weight of 313.15 g/mol. IUPAC name: tert-butyl N-(7-bromopyrrolo[2,1-f][1,2,4]triazin-4-yl)carbamate. InChIKey: NHHCWZGALMKHQJ-UHFFFAOYSA-N.
| Molecular formula | C11H13BrN4O2 |
|---|---|
| Molecular weight | 313.15 g/mol |
| IUPAC name | tert-butyl N-(7-bromopyrrolo[2,1-f][1,2,4]triazin-4-yl)carbamate |
| InChIKey | NHHCWZGALMKHQJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=NC=NN2C1=CC=C2Br |
Computed by PubChem (NCBI)
Synonyms:
tert-Butyl (7-bromopyrrolo[2,1-f][1,2,4]triazin-4-yl)carbamate, tert-butyl N-(7-bromopyrrolo[2,1-f][1,2,4]triazin-4-yl)carbamate, 7-Bromo-N-Boc-pyrrolo[2,1-f][1,2,4]triazin-4-amine, tert-butyl N-{7-bromopyrrolo[2,1-f][1,2,4]triazin-4-yl}carbamate, 4-(Boc-amino)-7-bromopyrrolo[2,1-f][1,2,4]triazine