cas: 1393813-40-5 — see every product listed under this CAS number, including other names
tert-Butyl (N-propylsulfamoyl)carbamate, 95%+, 95%+ (CAS 1393813-40-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110CA6-1g |
| cas | 1393813-40-5 |
| size | 1g |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 750.80 Pln | |
| Chemat | 5g | 2128.40 Pln | |
| Chemat | 10g | 3506.00 Pln |
| purity | 95%+ |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-(propylsulfamoyl)carbamate (CAS 1393813-40-5) is a chemical compound with the molecular formula C8H18N2O4S and a molecular weight of 238.31 g/mol. IUPAC name: tert-butyl N-(propylsulfamoyl)carbamate. InChIKey: DNKVAMMOETYAIM-UHFFFAOYSA-N.
| Molecular formula | C8H18N2O4S |
|---|---|
| Molecular weight | 238.31 g/mol |
| IUPAC name | tert-butyl N-(propylsulfamoyl)carbamate |
| InChIKey | DNKVAMMOETYAIM-UHFFFAOYSA-N |
| SMILES | CCCNS(=O)(=O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)